C17H15N5O4S — CID 59611981
3-[N-methyl-4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]anilino]propanoic acid (PubChem CID 59611981) has the molecular formula C17H15N5O4S and a molecular weight of 385.41 g/mol. Its IUPAC name is 3-[N-methyl-4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]anilino]propanoic acid.
| Compound Name | 3-[N-methyl-4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]anilino]propanoic acid |
|---|---|
| PubChem CID | 59611981 |
| Molecular Formula | C17H15N5O4S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 3-[N-methyl-4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]anilino]propanoic acid |
| SMILES | CN(CCC(=O)O)c1ccc(/N=N/c2nc3ccc([N+](=O)[O-])cc3s2)cc1 |
| InChI | InChI=1S/C17H15N5O4S/c1-21(9-8-16(23)24)12-4-2-11(3-5-12)19-20-17-18-14-7-6-13(22(25)26)10-15(14)27-17/h2-7,10H,8-9H2,1H3,(H,23,24)/b20-19+ |
| InChIKey | FZUHTXQHMZKXKK-FMQUCBEESA-N |
| XLogP | 4.53 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|