C19H19N5OS — CID 165342846
3-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)diazenyl]-N-methylanilino]propanenitrile (PubChem CID 165342846) has the molecular formula C19H19N5OS and a molecular weight of 365.46 g/mol. Its IUPAC name is 3-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)diazenyl]-N-methylanilino]propanenitrile.
| Compound Name | 3-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)diazenyl]-N-methylanilino]propanenitrile |
|---|---|
| PubChem CID | 165342846 |
| Molecular Formula | C19H19N5OS |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 3-[4-[(6-ethoxy-1,3-benzothiazol-2-yl)diazenyl]-N-methylanilino]propanenitrile |
| SMILES | CCOc1ccc2nc(/N=N/c3ccc(N(C)CCC#N)cc3)sc2c1 |
| InChI | InChI=1S/C19H19N5OS/c1-3-25-16-9-10-17-18(13-16)26-19(21-17)23-22-14-5-7-15(8-6-14)24(2)12-4-11-20/h5-10,13H,3-4,12H2,1-2H3/b23-22+ |
| InChIKey | PHNBKKGPEHIITL-GHVJWSGMSA-N |
| XLogP | 5.46 |
| TPSA | 73.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|