C21H24BrN3O2S — CID 102525993
[4-(6-bromohexoxy)phenyl]-(6-ethoxy-1,3-benzothiazol-2-yl)diazene (PubChem CID 102525993) has the molecular formula C21H24BrN3O2S and a molecular weight of 462.41 g/mol. Its IUPAC name is [4-(6-bromohexoxy)phenyl]-(6-ethoxy-1,3-benzothiazol-2-yl)diazene.
| Compound Name | [4-(6-bromohexoxy)phenyl]-(6-ethoxy-1,3-benzothiazol-2-yl)diazene |
|---|---|
| PubChem CID | 102525993 |
| Molecular Formula | C21H24BrN3O2S |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | [4-(6-bromohexoxy)phenyl]-(6-ethoxy-1,3-benzothiazol-2-yl)diazene |
| SMILES | CCOc1ccc2nc(/N=N/c3ccc(OCCCCCCBr)cc3)sc2c1 |
| InChI | InChI=1S/C21H24BrN3O2S/c1-2-26-18-11-12-19-20(15-18)28-21(23-19)25-24-16-7-9-17(10-8-16)27-14-6-4-3-5-13-22/h7-12,15H,2-6,13-14H2,1H3/b25-24+ |
| InChIKey | UWEFJBSGSMRNJJ-OCOZRVBESA-N |
| XLogP | 7.44 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|