C47H56N4O7 — CID 101415103
[3,5-bis[6-[4-[(4-ethoxyphenyl)diazenyl]phenoxy]hexoxy]phenyl]methanol (PubChem CID 101415103) has the molecular formula C47H56N4O7 and a molecular weight of 788.99 g/mol. Its IUPAC name is [3,5-bis[6-[4-[(4-ethoxyphenyl)diazenyl]phenoxy]hexoxy]phenyl]methanol.
| Compound Name | [3,5-bis[6-[4-[(4-ethoxyphenyl)diazenyl]phenoxy]hexoxy]phenyl]methanol |
|---|---|
| PubChem CID | 101415103 |
| Molecular Formula | C47H56N4O7 |
| Molecular Weight | 788.99 g/mol |
| Exact Mass | 788.41 |
| IUPAC Name | [3,5-bis[6-[4-[(4-ethoxyphenyl)diazenyl]phenoxy]hexoxy]phenyl]methanol |
| SMILES | CCOc1ccc(/N=N/c2ccc(OCCCCCCOc3cc(CO)cc(OCCCCCCOc4ccc(/N=N/c5ccc(OCC)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C47H56N4O7/c1-3-53-42-21-13-38(14-22-42)48-50-40-17-25-44(26-18-40)55-29-9-5-7-11-31-57-46-33-37(36-52)34-47(35-46)58-32-12-8-6-10-30-56-45-27-19-41(20-28-45)51-49-39-15-23-43(24-16-39)54-4-2/h13-28,33-35,52H,3-12,29-32,36H2,1-2H3/b50-48+,51-49+ |
| InChIKey | FGGOMUAWNLDGKC-BSLTZQBWSA-N |
| XLogP | 12.84 |
| TPSA | 125.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.99 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|