C60H63Br3N6O6 — CID 102136768
[4-[6-[3,5-bis[6-[4-[(4-bromophenyl)diazenyl]phenoxy]hexoxy]phenoxy]hexoxy]phenyl]-(4-bromophenyl)diazene (PubChem CID 102136768) has the molecular formula C60H63Br3N6O6 and a molecular weight of 1203.91 g/mol. Its IUPAC name is [4-[6-[3,5-bis[6-[4-[(4-bromophenyl)diazenyl]phenoxy]hexoxy]phenoxy]hexoxy]phenyl]-(4-bromophenyl)diazene.
| Compound Name | [4-[6-[3,5-bis[6-[4-[(4-bromophenyl)diazenyl]phenoxy]hexoxy]phenoxy]hexoxy]phenyl]-(4-bromophenyl)diazene |
|---|---|
| PubChem CID | 102136768 |
| Molecular Formula | C60H63Br3N6O6 |
| Molecular Weight | 1203.91 g/mol |
| Exact Mass | 1200.24 |
| IUPAC Name | [4-[6-[3,5-bis[6-[4-[(4-bromophenyl)diazenyl]phenoxy]hexoxy]phenoxy]hexoxy]phenyl]-(4-bromophenyl)diazene |
| SMILES | Brc1ccc(/N=N/c2ccc(OCCCCCCOc3cc(OCCCCCCOc4ccc(/N=N/c5ccc(Br)cc5)cc4)cc(OCCCCCCOc4ccc(/N=N/c5ccc(Br)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C60H63Br3N6O6/c61-46-13-19-49(20-14-46)64-67-52-25-31-55(32-26-52)70-37-7-1-4-10-40-73-58-43-59(74-41-11-5-2-8-38-71-56-33-27-53(28-34-56)68-65-50-21-15-47(62)16-22-50)45-60(44-58)75-42-12-6-3-9-39-72-57-35-29-54(30-36-57)69-66-51-23-17-48(63)18-24-51/h13-36,43-45H,1-12,37-42H2/b67-64+,68-65+,69-66+ |
| InChIKey | SUJYIFARYQKDDE-DNQNZXESSA-N |
| XLogP | 20.27 |
| TPSA | 129.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1203.91 |
| LogP ≤ 5 | 20.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|