C36H60N4O2 — CID 101082704
10-[4-[[4-[10-(dimethylamino)decoxy]phenyl]diazenyl]phenoxy]-N,N-dimethyldecan-1-amine (PubChem CID 101082704) has the molecular formula C36H60N4O2 and a molecular weight of 580.90 g/mol. Its IUPAC name is 10-[4-[[4-[10-(dimethylamino)decoxy]phenyl]diazenyl]phenoxy]-N,N-dimethyldecan-1-amine.
| Compound Name | 10-[4-[[4-[10-(dimethylamino)decoxy]phenyl]diazenyl]phenoxy]-N,N-dimethyldecan-1-amine |
|---|---|
| PubChem CID | 101082704 |
| Molecular Formula | C36H60N4O2 |
| Molecular Weight | 580.90 g/mol |
| Exact Mass | 580.47 |
| IUPAC Name | 10-[4-[[4-[10-(dimethylamino)decoxy]phenyl]diazenyl]phenoxy]-N,N-dimethyldecan-1-amine |
| SMILES | CN(C)CCCCCCCCCCOc1ccc(/N=N/c2ccc(OCCCCCCCCCCN(C)C)cc2)cc1 |
| InChI | InChI=1S/C36H60N4O2/c1-39(2)29-17-13-9-5-7-11-15-19-31-41-35-25-21-33(22-26-35)37-38-34-23-27-36(28-24-34)42-32-20-16-12-8-6-10-14-18-30-40(3)4/h21-28H,5-20,29-32H2,1-4H3/b38-37+ |
| InChIKey | AYQHMSIRDRFNEG-HEFFKOSUSA-N |
| XLogP | 10.22 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.90 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|