C22H31NO — CID 21281384
N,N-dimethyl-8-(4-phenylphenoxy)octan-1-amine (PubChem CID 21281384) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is N,N-dimethyl-8-(4-phenylphenoxy)octan-1-amine.
| Compound Name | N,N-dimethyl-8-(4-phenylphenoxy)octan-1-amine |
|---|---|
| PubChem CID | 21281384 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | N,N-dimethyl-8-(4-phenylphenoxy)octan-1-amine |
| SMILES | CN(C)CCCCCCCCOc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H31NO/c1-23(2)18-10-5-3-4-6-11-19-24-22-16-14-21(15-17-22)20-12-8-7-9-13-20/h7-9,12-17H,3-6,10-11,18-19H2,1-2H3 |
| InChIKey | XFOUFMQAZFXRPQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|