C18H24N2O — CID 2966313
N',N'-dimethyl-N-[2-(4-phenylphenoxy)ethyl]ethane-1,2-diamine (PubChem CID 2966313) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-(4-phenylphenoxy)ethyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[2-(4-phenylphenoxy)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 2966313 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N',N'-dimethyl-N-[2-(4-phenylphenoxy)ethyl]ethane-1,2-diamine |
| SMILES | CN(C)CCNCCOc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H24N2O/c1-20(2)14-12-19-13-15-21-18-10-8-17(9-11-18)16-6-4-3-5-7-16/h3-11,19H,12-15H2,1-2H3 |
| InChIKey | TWKSPPWABGWIKG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|