C12H18ClFN2O — CID 82727158
N-[2-(4-chloro-3-fluorophenoxy)ethyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 82727158) has the molecular formula C12H18ClFN2O and a molecular weight of 260.74 g/mol. Its IUPAC name is N-[2-(4-chloro-3-fluorophenoxy)ethyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[2-(4-chloro-3-fluorophenoxy)ethyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 82727158 |
| Molecular Formula | C12H18ClFN2O |
| Molecular Weight | 260.74 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-[2-(4-chloro-3-fluorophenoxy)ethyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNCCOc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C12H18ClFN2O/c1-16(2)7-5-15-6-8-17-10-3-4-11(13)12(14)9-10/h3-4,9,15H,5-8H2,1-2H3 |
| InChIKey | LOJUSHUKKRNNLZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.74 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|