C31H39N5O2SSi — CID 170542708
[4-[2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxyethyl]phenyl]-[2-[(4-ethoxyphenyl)diazenyl]-1,3-benzothiazol-5-yl]diazene (PubChem CID 170542708) has the molecular formula C31H39N5O2SSi and a molecular weight of 573.84 g/mol. Its IUPAC name is [4-[2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxyethyl]phenyl]-[2-[(4-ethoxyphenyl)diazenyl]-1,3-benzothiazol-5-yl]diazene.
| Compound Name | [4-[2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxyethyl]phenyl]-[2-[(4-ethoxyphenyl)diazenyl]-1,3-benzothiazol-5-yl]diazene |
|---|---|
| PubChem CID | 170542708 |
| Molecular Formula | C31H39N5O2SSi |
| Molecular Weight | 573.84 g/mol |
| Exact Mass | 573.26 |
| IUPAC Name | [4-[2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxyethyl]phenyl]-[2-[(4-ethoxyphenyl)diazenyl]-1,3-benzothiazol-5-yl]diazene |
| SMILES | CCOc1ccc(/N=N/c2nc3cc(/N=N/c4ccc(CCO[Si](C)(C)C(C)(C)C(C)C)cc4)ccc3s2)cc1 |
| InChI | InChI=1S/C31H39N5O2SSi/c1-8-37-27-16-13-25(14-17-27)34-36-30-32-28-21-26(15-18-29(28)39-30)35-33-24-11-9-23(10-12-24)19-20-38-40(6,7)31(4,5)22(2)3/h9-18,21-22H,8,19-20H2,1-7H3/b35-33+,36-34+ |
| InChIKey | JGZDJOUSANDOSZ-LBYUQGKWSA-N |
| XLogP | 10.73 |
| TPSA | 80.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.84 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|