C30H40N6OS2Si — CID 170542713
4-[[5-[[4-[2-[diethyl(propan-2-yl)silyl]oxyethyl]phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]-N,N-diethylaniline (PubChem CID 170542713) has the molecular formula C30H40N6OS2Si and a molecular weight of 592.91 g/mol. Its IUPAC name is 4-[[5-[[4-[2-[diethyl(propan-2-yl)silyl]oxyethyl]phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]-N,N-diethylaniline.
| Compound Name | 4-[[5-[[4-[2-[diethyl(propan-2-yl)silyl]oxyethyl]phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 170542713 |
| Molecular Formula | C30H40N6OS2Si |
| Molecular Weight | 592.91 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | 4-[[5-[[4-[2-[diethyl(propan-2-yl)silyl]oxyethyl]phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/N=N/c2nc3sc(/N=N/c4ccc(CCO[Si](CC)(CC)C(C)C)cc4)cc3s2)cc1 |
| InChI | InChI=1S/C30H40N6OS2Si/c1-7-36(8-2)26-17-15-25(16-18-26)33-35-30-31-29-27(38-30)21-28(39-29)34-32-24-13-11-23(12-14-24)19-20-37-40(9-3,10-4)22(5)6/h11-18,21-22H,7-10,19-20H2,1-6H3/b34-32+,35-33+ |
| InChIKey | TXFGXKQUJZEJHF-XUXOKTBYSA-N |
| XLogP | 10.99 |
| TPSA | 74.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.91 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|