C36H32N6O2S2 — CID 59348845
[4-[[2-[[4-(diethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl] 4-(4-ethylphenyl)benzoate (PubChem CID 59348845) has the molecular formula C36H32N6O2S2 and a molecular weight of 644.83 g/mol. Its IUPAC name is [4-[[2-[[4-(diethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl] 4-(4-ethylphenyl)benzoate.
| Compound Name | [4-[[2-[[4-(diethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl] 4-(4-ethylphenyl)benzoate |
|---|---|
| PubChem CID | 59348845 |
| Molecular Formula | C36H32N6O2S2 |
| Molecular Weight | 644.83 g/mol |
| Exact Mass | 644.20 |
| IUPAC Name | [4-[[2-[[4-(diethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl] 4-(4-ethylphenyl)benzoate |
| SMILES | CCc1ccc(-c2ccc(C(=O)Oc3ccc(/N=N/c4cc5sc(/N=N/c6ccc(N(CC)CC)cc6)nc5s4)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H32N6O2S2/c1-4-24-7-9-25(10-8-24)26-11-13-27(14-12-26)35(43)44-31-21-17-29(18-22-31)38-40-33-23-32-34(46-33)37-36(45-32)41-39-28-15-19-30(20-16-28)42(5-2)6-3/h7-23H,4-6H2,1-3H3/b40-38+,41-39+ |
| InChIKey | KAPJKDNPUHBGHR-QYGUTFKISA-N |
| XLogP | 11.48 |
| TPSA | 91.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.83 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|