C23H22N6O2S2 — CID 129101587
4-[[2-[[4-[ethyl(propyl)amino]phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzoic acid (PubChem CID 129101587) has the molecular formula C23H22N6O2S2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 4-[[2-[[4-[ethyl(propyl)amino]phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzoic acid.
| Compound Name | 4-[[2-[[4-[ethyl(propyl)amino]phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 129101587 |
| Molecular Formula | C23H22N6O2S2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 4-[[2-[[4-[ethyl(propyl)amino]phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzoic acid |
| SMILES | CCCN(CC)c1ccc(/N=N/c2nc3sc(/N=N/c4ccc(C(=O)O)cc4)cc3s2)cc1 |
| InChI | InChI=1S/C23H22N6O2S2/c1-3-13-29(4-2)18-11-9-17(10-12-18)26-28-23-24-21-19(32-23)14-20(33-21)27-25-16-7-5-15(6-8-16)22(30)31/h5-12,14H,3-4,13H2,1-2H3,(H,30,31)/b27-25+,28-26+ |
| InChIKey | FPIOZUFOMOYYAL-NBHCHVEOSA-N |
| XLogP | 8.12 |
| TPSA | 102.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|