C24H22N6OS2 — CID 129088562
1-[4-[[2-[(4-piperidin-1-ylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl]ethanone (PubChem CID 129088562) has the molecular formula C24H22N6OS2 and a molecular weight of 474.62 g/mol. Its IUPAC name is 1-[4-[[2-[(4-piperidin-1-ylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl]ethanone.
| Compound Name | 1-[4-[[2-[(4-piperidin-1-ylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl]ethanone |
|---|---|
| PubChem CID | 129088562 |
| Molecular Formula | C24H22N6OS2 |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 1-[4-[[2-[(4-piperidin-1-ylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(/N=N/c2cc3sc(/N=N/c4ccc(N5CCCCC5)cc4)nc3s2)cc1 |
| InChI | InChI=1S/C24H22N6OS2/c1-16(31)17-5-7-18(8-6-17)26-28-22-15-21-23(33-22)25-24(32-21)29-27-19-9-11-20(12-10-19)30-13-3-2-4-14-30/h5-12,15H,2-4,13-14H2,1H3/b28-26+,29-27+ |
| InChIKey | WSDSPHSSWVCLII-TUUFZWAFSA-N |
| XLogP | 8.38 |
| TPSA | 82.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|