C38H40N4O2S2 — CID 170369102
(4-butylphenyl) (Z)-2-(4-butylphenyl)-3-[2-[(4-pyrrolidin-1-ylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]prop-2-enoate (PubChem CID 170369102) has the molecular formula C38H40N4O2S2 and a molecular weight of 648.90 g/mol. Its IUPAC name is (4-butylphenyl) (Z)-2-(4-butylphenyl)-3-[2-[(4-pyrrolidin-1-ylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]prop-2-enoate.
| Compound Name | (4-butylphenyl) (Z)-2-(4-butylphenyl)-3-[2-[(4-pyrrolidin-1-ylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 170369102 |
| Molecular Formula | C38H40N4O2S2 |
| Molecular Weight | 648.90 g/mol |
| Exact Mass | 648.26 |
| IUPAC Name | (4-butylphenyl) (Z)-2-(4-butylphenyl)-3-[2-[(4-pyrrolidin-1-ylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]prop-2-enoate |
| SMILES | CCCCc1ccc(OC(=O)/C(=C\c2cc3sc(/N=N/c4ccc(N5CCCC5)cc4)nc3s2)c2ccc(CCCC)cc2)cc1 |
| InChI | InChI=1S/C38H40N4O2S2/c1-3-5-9-27-11-15-29(16-12-27)34(37(43)44-32-21-13-28(14-22-32)10-6-4-2)25-33-26-35-36(45-33)39-38(46-35)41-40-30-17-19-31(20-18-30)42-23-7-8-24-42/h11-22,25-26H,3-10,23-24H2,1-2H3/b34-25-,41-40+ |
| InChIKey | ICIUWPSLGYWKMV-LWNRINPFSA-N |
| XLogP | 11.20 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.90 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|