C30H29N9S4 — CID 123508267
4-[[5-[[5-[(4-butylphenyl)diazenyl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]iminomethyl]thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]-N,N-diethylaniline (PubChem CID 123508267) has the molecular formula C30H29N9S4 and a molecular weight of 643.89 g/mol. Its IUPAC name is 4-[[5-[[5-[(4-butylphenyl)diazenyl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]iminomethyl]thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]-N,N-diethylaniline.
| Compound Name | 4-[[5-[[5-[(4-butylphenyl)diazenyl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]iminomethyl]thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 123508267 |
| Molecular Formula | C30H29N9S4 |
| Molecular Weight | 643.89 g/mol |
| Exact Mass | 643.14 |
| IUPAC Name | 4-[[5-[[5-[(4-butylphenyl)diazenyl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]iminomethyl]thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]-N,N-diethylaniline |
| SMILES | CCCCc1ccc(/N=N/c2nc3sc(N=Cc4cc5sc(/N=N/c6ccc(N(CC)CC)cc6)nc5s4)nc3s2)cc1 |
| InChI | InChI=1S/C30H29N9S4/c1-4-7-8-19-9-11-20(12-10-19)35-38-30-34-27-26(43-30)33-28(42-27)31-18-23-17-24-25(40-23)32-29(41-24)37-36-21-13-15-22(16-14-21)39(5-2)6-3/h9-18H,4-8H2,1-3H3/b31-18?,37-36+,38-35+ |
| InChIKey | CHJJGDQHRSLUBS-TYOBRMCPSA-N |
| XLogP | 11.19 |
| TPSA | 103.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.89 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|