C30H33N5OS2 — CID 166664702
(Z)-3-[2-[[4-(diethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]-2-(4-hexoxyphenyl)prop-2-enenitrile (PubChem CID 166664702) has the molecular formula C30H33N5OS2 and a molecular weight of 543.76 g/mol. Its IUPAC name is (Z)-3-[2-[[4-(diethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]-2-(4-hexoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[2-[[4-(diethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]-2-(4-hexoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 166664702 |
| Molecular Formula | C30H33N5OS2 |
| Molecular Weight | 543.76 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | (Z)-3-[2-[[4-(diethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]-2-(4-hexoxyphenyl)prop-2-enenitrile |
| SMILES | CCCCCCOc1ccc(/C(C#N)=C/c2cc3sc(/N=N/c4ccc(N(CC)CC)cc4)nc3s2)cc1 |
| InChI | InChI=1S/C30H33N5OS2/c1-4-7-8-9-18-36-26-16-10-22(11-17-26)23(21-31)19-27-20-28-29(37-27)32-30(38-28)34-33-24-12-14-25(15-13-24)35(5-2)6-3/h10-17,19-20H,4-9,18H2,1-3H3/b23-19+,34-33+ |
| InChIKey | CRZKVMMGGKOLCE-UGOWPHODSA-N |
| XLogP | 9.64 |
| TPSA | 73.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.76 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|