C39H46N6O7S2 — CID 156628712
9-[4-[[2-[[4-[ethyl(2-prop-2-enoyloxyethyl)amino]phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenoxy]nonyl 2-prop-2-enoyloxypropanoate (PubChem CID 156628712) has the molecular formula C39H46N6O7S2 and a molecular weight of 774.97 g/mol. Its IUPAC name is 9-[4-[[2-[[4-[ethyl(2-prop-2-enoyloxyethyl)amino]phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenoxy]nonyl 2-prop-2-enoyloxypropanoate.
| Compound Name | 9-[4-[[2-[[4-[ethyl(2-prop-2-enoyloxyethyl)amino]phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenoxy]nonyl 2-prop-2-enoyloxypropanoate |
|---|---|
| PubChem CID | 156628712 |
| Molecular Formula | C39H46N6O7S2 |
| Molecular Weight | 774.97 g/mol |
| Exact Mass | 774.29 |
| IUPAC Name | 9-[4-[[2-[[4-[ethyl(2-prop-2-enoyloxyethyl)amino]phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenoxy]nonyl 2-prop-2-enoyloxypropanoate |
| SMILES | C=CC(=O)OCCN(CC)c1ccc(/N=N/c2nc3sc(/N=N/c4ccc(OCCCCCCCCCOC(=O)C(C)OC(=O)C=C)cc4)cc3s2)cc1 |
| InChI | InChI=1S/C39H46N6O7S2/c1-5-35(46)50-26-23-45(7-3)31-19-15-29(16-20-31)42-44-39-40-37-33(53-39)27-34(54-37)43-41-30-17-21-32(22-18-30)49-24-13-11-9-8-10-12-14-25-51-38(48)28(4)52-36(47)6-2/h5-6,15-22,27-28H,1-2,7-14,23-26H2,3-4H3/b43-41+,44-42+ |
| InChIKey | RJXRNSOVSPHTSR-CHQNLTHESA-N |
| XLogP | 10.51 |
| TPSA | 153.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.97 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|