C22H22N6OS2 — CID 170542659
[4-[[2-[[4-(diethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl]methanol (PubChem CID 170542659) has the molecular formula C22H22N6OS2 and a molecular weight of 450.59 g/mol. Its IUPAC name is [4-[[2-[[4-(diethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl]methanol.
| Compound Name | [4-[[2-[[4-(diethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl]methanol |
|---|---|
| PubChem CID | 170542659 |
| Molecular Formula | C22H22N6OS2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | [4-[[2-[[4-(diethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl]methanol |
| SMILES | CCN(CC)c1ccc(/N=N/c2nc3sc(/N=N/c4ccc(CO)cc4)cc3s2)cc1 |
| InChI | InChI=1S/C22H22N6OS2/c1-3-28(4-2)18-11-9-17(10-12-18)25-27-22-23-21-19(30-22)13-20(31-21)26-24-16-7-5-15(14-29)6-8-16/h5-13,29H,3-4,14H2,1-2H3/b26-24+,27-25+ |
| InChIKey | LAEGTLZEXXLRHT-OWUYFMIJSA-N |
| XLogP | 7.53 |
| TPSA | 85.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|