C35H32N6S2 — CID 59348852
4-[[5-[(4-butylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]-N-methyl-N-[(4-phenylphenyl)methyl]aniline (PubChem CID 59348852) has the molecular formula C35H32N6S2 and a molecular weight of 600.82 g/mol. Its IUPAC name is 4-[[5-[(4-butylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]-N-methyl-N-[(4-phenylphenyl)methyl]aniline.
| Compound Name | 4-[[5-[(4-butylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]-N-methyl-N-[(4-phenylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 59348852 |
| Molecular Formula | C35H32N6S2 |
| Molecular Weight | 600.82 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | 4-[[5-[(4-butylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]-N-methyl-N-[(4-phenylphenyl)methyl]aniline |
| SMILES | CCCCc1ccc(/N=N/c2cc3sc(/N=N/c4ccc(N(C)Cc5ccc(-c6ccccc6)cc5)cc4)nc3s2)cc1 |
| InChI | InChI=1S/C35H32N6S2/c1-3-4-8-25-13-17-29(18-14-25)37-39-33-23-32-34(43-33)36-35(42-32)40-38-30-19-21-31(22-20-30)41(2)24-26-11-15-28(16-12-26)27-9-6-5-7-10-27/h5-7,9-23H,3-4,8,24H2,1-2H3/b39-37+,40-38+ |
| InChIKey | FSMDVICGDHXZDF-HVMBLDELSA-N |
| XLogP | 11.83 |
| TPSA | 65.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.82 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|