C29H34N6O3S2Si — CID 170542680
[2-[4-[[2-[[4-(diethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl]ethoxy-dimethylsilyl]methyl prop-2-enoate (PubChem CID 170542680) has the molecular formula C29H34N6O3S2Si and a molecular weight of 606.85 g/mol. Its IUPAC name is [2-[4-[[2-[[4-(diethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl]ethoxy-dimethylsilyl]methyl prop-2-enoate.
| Compound Name | [2-[4-[[2-[[4-(diethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl]ethoxy-dimethylsilyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 170542680 |
| Molecular Formula | C29H34N6O3S2Si |
| Molecular Weight | 606.85 g/mol |
| Exact Mass | 606.19 |
| IUPAC Name | [2-[4-[[2-[[4-(diethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl]ethoxy-dimethylsilyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OC[Si](C)(C)OCCc1ccc(/N=N/c2cc3sc(/N=N/c4ccc(N(CC)CC)cc4)nc3s2)cc1 |
| InChI | InChI=1S/C29H34N6O3S2Si/c1-6-27(36)37-20-41(4,5)38-18-17-21-9-11-22(12-10-21)31-33-26-19-25-28(40-26)30-29(39-25)34-32-23-13-15-24(16-14-23)35(7-2)8-3/h6,9-16,19H,1,7-8,17-18,20H2,2-5H3/b33-31+,34-32+ |
| InChIKey | FDSOXYGSLCFPEJ-FMWAKIAMSA-N |
| XLogP | 9.07 |
| TPSA | 101.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.85 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|