C25H24N6O2S2 — CID 167346497
2-[4-[[2-[[4-(ethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 167346497) has the molecular formula C25H24N6O2S2 and a molecular weight of 504.64 g/mol. Its IUPAC name is 2-[4-[[2-[[4-(ethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[[2-[[4-(ethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 167346497 |
| Molecular Formula | C25H24N6O2S2 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 2-[4-[[2-[[4-(ethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1ccc(/N=N/c2cc3sc(/N=N/c4ccc(NCC)cc4)nc3s2)cc1 |
| InChI | InChI=1S/C25H24N6O2S2/c1-4-26-18-9-11-20(12-10-18)29-31-25-27-23-21(34-25)15-22(35-23)30-28-19-7-5-17(6-8-19)13-14-33-24(32)16(2)3/h5-12,15,26H,2,4,13-14H2,1,3H3/b30-28+,31-29+ |
| InChIKey | ZCWOOFZHRPOZTD-FUEWEDNTSA-N |
| XLogP | 8.28 |
| TPSA | 100.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|