C14H13N5S — CID 86249746
N-ethyl-4-([1,3]thiazolo[5,4-c]pyridin-2-yldiazenyl)aniline (PubChem CID 86249746) has the molecular formula C14H13N5S and a molecular weight of 283.36 g/mol. Its IUPAC name is N-ethyl-4-([1,3]thiazolo[5,4-c]pyridin-2-yldiazenyl)aniline.
| Compound Name | N-ethyl-4-([1,3]thiazolo[5,4-c]pyridin-2-yldiazenyl)aniline |
|---|---|
| PubChem CID | 86249746 |
| Molecular Formula | C14H13N5S |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | N-ethyl-4-([1,3]thiazolo[5,4-c]pyridin-2-yldiazenyl)aniline |
| SMILES | CCNc1ccc(/N=N/c2nc3ccncc3s2)cc1 |
| InChI | InChI=1S/C14H13N5S/c1-2-16-10-3-5-11(6-4-10)18-19-14-17-12-7-8-15-9-13(12)20-14/h3-9,16H,2H2,1H3/b19-18+ |
| InChIKey | VGINMPLJHODHQQ-VHEBQXMUSA-N |
| XLogP | 4.54 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|