C24H23N3 — CID 145465310
4-[4-(3,4-dimethyl-1,6-naphthyridin-2-yl)phenyl]-N-ethylaniline (PubChem CID 145465310) has the molecular formula C24H23N3 and a molecular weight of 353.47 g/mol. Its IUPAC name is 4-[4-(3,4-dimethyl-1,6-naphthyridin-2-yl)phenyl]-N-ethylaniline.
| Compound Name | 4-[4-(3,4-dimethyl-1,6-naphthyridin-2-yl)phenyl]-N-ethylaniline |
|---|---|
| PubChem CID | 145465310 |
| Molecular Formula | C24H23N3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 4-[4-(3,4-dimethyl-1,6-naphthyridin-2-yl)phenyl]-N-ethylaniline |
| SMILES | CCNc1ccc(-c2ccc(-c3nc4ccncc4c(C)c3C)cc2)cc1 |
| InChI | InChI=1S/C24H23N3/c1-4-26-21-11-9-19(10-12-21)18-5-7-20(8-6-18)24-17(3)16(2)22-15-25-14-13-23(22)27-24/h5-15,26H,4H2,1-3H3 |
| InChIKey | MNWJQRDSNPMRDA-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |