C17H19N4NaO3S3 — CID 168747184
sodium [4-[[5-(3-methylbutyl)thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]anilino]methanesulfonate (PubChem CID 168747184) has the molecular formula C17H19N4NaO3S3 and a molecular weight of 446.56 g/mol. Its IUPAC name is sodium [4-[[5-(3-methylbutyl)thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]anilino]methanesulfonate.
| Compound Name | sodium [4-[[5-(3-methylbutyl)thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]anilino]methanesulfonate |
|---|---|
| PubChem CID | 168747184 |
| Molecular Formula | C17H19N4NaO3S3 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | sodium [4-[[5-(3-methylbutyl)thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]anilino]methanesulfonate |
| SMILES | CC(C)CCc1cc2sc(/N=N/c3ccc(NCS(=O)(=O)[O-])cc3)nc2s1.[Na+] |
| InChI | InChI=1S/C17H20N4O3S3.Na/c1-11(2)3-8-14-9-15-16(25-14)19-17(26-15)21-20-13-6-4-12(5-7-13)18-10-27(22,23)24;/h4-7,9,11,18H,3,8,10H2,1-2H3,(H,22,23,24);/q;+1/p-1/b21-20+; |
| InChIKey | FKHQECCDVIJYLU-ANVLNOONSA-M |
| XLogP | 2.28 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|