C20H22N6O2S — CID 71495448
N-(4,6-dimethylpyrimidin-2-yl)-4-[[4-(ethylamino)phenyl]diazenyl]benzenesulfonamide (PubChem CID 71495448) has the molecular formula C20H22N6O2S and a molecular weight of 410.50 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)-4-[[4-(ethylamino)phenyl]diazenyl]benzenesulfonamide.
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)-4-[[4-(ethylamino)phenyl]diazenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71495448 |
| Molecular Formula | C20H22N6O2S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)-4-[[4-(ethylamino)phenyl]diazenyl]benzenesulfonamide |
| SMILES | CCNc1ccc(/N=N/c2ccc(S(=O)(=O)Nc3nc(C)cc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C20H22N6O2S/c1-4-21-16-5-7-17(8-6-16)24-25-18-9-11-19(12-10-18)29(27,28)26-20-22-14(2)13-15(3)23-20/h5-13,21H,4H2,1-3H3,(H,22,23,26)/b25-24+ |
| InChIKey | YQYVEUIPZBLUFA-OCOZRVBESA-N |
| XLogP | 4.74 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|