C16H15N7O4S2 — CID 4626550
N-(4,6-dimethylpyrimidin-2-yl)-4-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)diazenyl]benzenesulfonamide (PubChem CID 4626550) has the molecular formula C16H15N7O4S2 and a molecular weight of 433.48 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)-4-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)diazenyl]benzenesulfonamide.
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)-4-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)diazenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4626550 |
| Molecular Formula | C16H15N7O4S2 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)-4-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)diazenyl]benzenesulfonamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(/N=N/c3c(O)[nH]c(=S)[nH]c3=O)cc2)n1 |
| InChI | InChI=1S/C16H15N7O4S2/c1-8-7-9(2)18-15(17-8)23-29(26,27)11-5-3-10(4-6-11)21-22-12-13(24)19-16(28)20-14(12)25/h3-7H,1-2H3,(H,17,18,23)(H3,19,20,24,25,28)/b22-21+ |
| InChIKey | AMIANNOEUKEHJD-QURGRASLSA-N |
| XLogP | 2.76 |
| TPSA | 165.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|