C27H23N5O4S — CID 135418668
N-(4,6-dimethylpyrimidin-2-yl)-4-[[(E)-1-hydroxy-3-oxo-1,3-diphenylprop-1-en-2-yl]diazenyl]benzenesulfonamide (PubChem CID 135418668) has the molecular formula C27H23N5O4S and a molecular weight of 513.58 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)-4-[[(E)-1-hydroxy-3-oxo-1,3-diphenylprop-1-en-2-yl]diazenyl]benzenesulfonamide.
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)-4-[[(E)-1-hydroxy-3-oxo-1,3-diphenylprop-1-en-2-yl]diazenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135418668 |
| Molecular Formula | C27H23N5O4S |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)-4-[[(E)-1-hydroxy-3-oxo-1,3-diphenylprop-1-en-2-yl]diazenyl]benzenesulfonamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(/N=N/C(C(=O)c3ccccc3)=C(/O)c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C27H23N5O4S/c1-18-17-19(2)29-27(28-18)32-37(35,36)23-15-13-22(14-16-23)30-31-24(25(33)20-9-5-3-6-10-20)26(34)21-11-7-4-8-12-21/h3-17,33H,1-2H3,(H,28,29,32)/b25-24+,31-30+ |
| InChIKey | SCJSEBIRNVNDQV-SCGOWUEXSA-N |
| XLogP | 5.79 |
| TPSA | 133.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|