C21H18N6O3S — CID 134107096
(1E)-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]anilino]-2-oxo-2-phenylethanimidoyl cyanide (PubChem CID 134107096) has the molecular formula C21H18N6O3S and a molecular weight of 434.48 g/mol. Its IUPAC name is (1E)-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]anilino]-2-oxo-2-phenylethanimidoyl cyanide.
| Compound Name | (1E)-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]anilino]-2-oxo-2-phenylethanimidoyl cyanide |
|---|---|
| PubChem CID | 134107096 |
| Molecular Formula | C21H18N6O3S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | (1E)-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]anilino]-2-oxo-2-phenylethanimidoyl cyanide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(N/N=C(\C#N)C(=O)c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C21H18N6O3S/c1-14-12-15(2)24-21(23-14)27-31(29,30)18-10-8-17(9-11-18)25-26-19(13-22)20(28)16-6-4-3-5-7-16/h3-12,25H,1-2H3,(H,23,24,27)/b26-19+ |
| InChIKey | ZLQATAAHYYRVBN-LGUFXXKBSA-N |
| XLogP | 3.07 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|