C16H16N6O4S — CID 6374240
methyl (2E)-2-cyano-2-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]hydrazinylidene]acetate (PubChem CID 6374240) has the molecular formula C16H16N6O4S and a molecular weight of 388.41 g/mol. Its IUPAC name is methyl (2E)-2-cyano-2-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]hydrazinylidene]acetate.
| Compound Name | methyl (2E)-2-cyano-2-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]hydrazinylidene]acetate |
|---|---|
| PubChem CID | 6374240 |
| Molecular Formula | C16H16N6O4S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | methyl (2E)-2-cyano-2-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]hydrazinylidene]acetate |
| SMILES | COC(=O)/C(C#N)=N/Nc1ccc(S(=O)(=O)Nc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C16H16N6O4S/c1-10-8-11(2)19-16(18-10)22-27(24,25)13-6-4-12(5-7-13)20-21-14(9-17)15(23)26-3/h4-8,20H,1-3H3,(H,18,19,22)/b21-14+ |
| InChIKey | LBSAONYBCSVGGG-KGENOOAVSA-N |
| XLogP | 1.36 |
| TPSA | 146.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|