C15H20N4O4S — CID 21236975
ethyl (2E)-2-cyano-2-[[4-(diethylsulfamoyl)phenyl]hydrazinylidene]acetate (PubChem CID 21236975) has the molecular formula C15H20N4O4S and a molecular weight of 352.42 g/mol. Its IUPAC name is ethyl (2E)-2-cyano-2-[[4-(diethylsulfamoyl)phenyl]hydrazinylidene]acetate.
| Compound Name | ethyl (2E)-2-cyano-2-[[4-(diethylsulfamoyl)phenyl]hydrazinylidene]acetate |
|---|---|
| PubChem CID | 21236975 |
| Molecular Formula | C15H20N4O4S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | ethyl (2E)-2-cyano-2-[[4-(diethylsulfamoyl)phenyl]hydrazinylidene]acetate |
| SMILES | CCOC(=O)/C(C#N)=N/Nc1ccc(S(=O)(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C15H20N4O4S/c1-4-19(5-2)24(21,22)13-9-7-12(8-10-13)17-18-14(11-16)15(20)23-6-3/h7-10,17H,4-6H2,1-3H3/b18-14+ |
| InChIKey | BMTBQFNLABQSOQ-NBVRZTHBSA-N |
| XLogP | 1.57 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|