C11H8Cl3N3O2 — CID 23275272
ethyl 2-cyano-2-[(2,4,5-trichlorophenyl)hydrazinylidene]acetate (PubChem CID 23275272) has the molecular formula C11H8Cl3N3O2 and a molecular weight of 320.56 g/mol. Its IUPAC name is ethyl 2-cyano-2-[(2,4,5-trichlorophenyl)hydrazinylidene]acetate.
| Compound Name | ethyl 2-cyano-2-[(2,4,5-trichlorophenyl)hydrazinylidene]acetate |
|---|---|
| PubChem CID | 23275272 |
| Molecular Formula | C11H8Cl3N3O2 |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | ethyl 2-cyano-2-[(2,4,5-trichlorophenyl)hydrazinylidene]acetate |
| SMILES | CCOC(=O)C(C#N)=NNc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H8Cl3N3O2/c1-2-19-11(18)10(5-15)17-16-9-4-7(13)6(12)3-8(9)14/h3-4,16H,2H2,1H3 |
| InChIKey | SPCDQYLMZJOFHZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|