C9H5Cl3N4S — CID 5420104
(1E)-2-amino-2-sulfanylidene-N-(2,4,5-trichloroanilino)ethanimidoyl cyanide (PubChem CID 5420104) has the molecular formula C9H5Cl3N4S and a molecular weight of 307.59 g/mol. Its IUPAC name is (1E)-2-amino-2-sulfanylidene-N-(2,4,5-trichloroanilino)ethanimidoyl cyanide.
| Compound Name | (1E)-2-amino-2-sulfanylidene-N-(2,4,5-trichloroanilino)ethanimidoyl cyanide |
|---|---|
| PubChem CID | 5420104 |
| Molecular Formula | C9H5Cl3N4S |
| Molecular Weight | 307.59 g/mol |
| Exact Mass | 305.93 |
| IUPAC Name | (1E)-2-amino-2-sulfanylidene-N-(2,4,5-trichloroanilino)ethanimidoyl cyanide |
| SMILES | N#C/C(=N\Nc1cc(Cl)c(Cl)cc1Cl)C(N)=S |
| InChI | InChI=1S/C9H5Cl3N4S/c10-4-1-6(12)7(2-5(4)11)15-16-8(3-13)9(14)17/h1-2,15H,(H2,14,17)/b16-8+ |
| InChIKey | YLKYXSKYADULMG-LZYBPNLTSA-N |
| XLogP | 3.22 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|