C10H7F3N4S — CID 5372832
(1Z)-2-amino-2-sulfanylidene-N-[2-(trifluoromethyl)anilino]ethanimidoyl cyanide (PubChem CID 5372832) has the molecular formula C10H7F3N4S and a molecular weight of 272.26 g/mol. Its IUPAC name is (1Z)-2-amino-2-sulfanylidene-N-[2-(trifluoromethyl)anilino]ethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-2-sulfanylidene-N-[2-(trifluoromethyl)anilino]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 5372832 |
| Molecular Formula | C10H7F3N4S |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | (1Z)-2-amino-2-sulfanylidene-N-[2-(trifluoromethyl)anilino]ethanimidoyl cyanide |
| SMILES | N#C/C(=N/Nc1ccccc1C(F)(F)F)C(N)=S |
| InChI | InChI=1S/C10H7F3N4S/c11-10(12,13)6-3-1-2-4-7(6)16-17-8(5-14)9(15)18/h1-4,16H,(H2,15,18)/b17-8- |
| InChIKey | AVCQQCYPFCUDIL-IUXPMGMMSA-N |
| XLogP | 2.28 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|