C11H8Cl2N4O4 — CID 5333581
ethyl (2E)-2-cyano-2-[(2,5-dichloro-4-nitrophenyl)hydrazinylidene]acetate (PubChem CID 5333581) has the molecular formula C11H8Cl2N4O4 and a molecular weight of 331.12 g/mol. Its IUPAC name is ethyl (2E)-2-cyano-2-[(2,5-dichloro-4-nitrophenyl)hydrazinylidene]acetate.
| Compound Name | ethyl (2E)-2-cyano-2-[(2,5-dichloro-4-nitrophenyl)hydrazinylidene]acetate |
|---|---|
| PubChem CID | 5333581 |
| Molecular Formula | C11H8Cl2N4O4 |
| Molecular Weight | 331.12 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | ethyl (2E)-2-cyano-2-[(2,5-dichloro-4-nitrophenyl)hydrazinylidene]acetate |
| SMILES | CCOC(=O)/C(C#N)=N/Nc1cc(Cl)c([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C11H8Cl2N4O4/c1-2-21-11(18)9(5-14)16-15-8-3-7(13)10(17(19)20)4-6(8)12/h3-4,15H,2H2,1H3/b16-9+ |
| InChIKey | AOOUGHMHVVKTRR-CXUHLZMHSA-N |
| XLogP | 2.76 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.12 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|