C13H12Cl3N3O — CID 57376629
3,3-dimethyl-2-oxo-N-(2,4,5-trichloroanilino)butanimidoyl cyanide (PubChem CID 57376629) has the molecular formula C13H12Cl3N3O and a molecular weight of 332.62 g/mol. Its IUPAC name is 3,3-dimethyl-2-oxo-N-(2,4,5-trichloroanilino)butanimidoyl cyanide.
| Compound Name | 3,3-dimethyl-2-oxo-N-(2,4,5-trichloroanilino)butanimidoyl cyanide |
|---|---|
| PubChem CID | 57376629 |
| Molecular Formula | C13H12Cl3N3O |
| Molecular Weight | 332.62 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 3,3-dimethyl-2-oxo-N-(2,4,5-trichloroanilino)butanimidoyl cyanide |
| SMILES | CC(C)(C)C(=O)C(C#N)=NNc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H12Cl3N3O/c1-13(2,3)12(20)11(6-17)19-18-10-5-8(15)7(14)4-9(10)16/h4-5,18H,1-3H3 |
| InChIKey | PVGGVFZBPCMSTD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|