C13H11N3O6 — CID 6899391
5-[(2E)-2-(1-cyano-2-ethoxy-2-oxoethylidene)hydrazinyl]benzene-1,3-dicarboxylic acid (PubChem CID 6899391) has the molecular formula C13H11N3O6 and a molecular weight of 305.25 g/mol. Its IUPAC name is 5-[(2E)-2-(1-cyano-2-ethoxy-2-oxoethylidene)hydrazinyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[(2E)-2-(1-cyano-2-ethoxy-2-oxoethylidene)hydrazinyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 6899391 |
| Molecular Formula | C13H11N3O6 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 5-[(2E)-2-(1-cyano-2-ethoxy-2-oxoethylidene)hydrazinyl]benzene-1,3-dicarboxylic acid |
| SMILES | CCOC(=O)/C(C#N)=N/Nc1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C13H11N3O6/c1-2-22-13(21)10(6-14)16-15-9-4-7(11(17)18)3-8(5-9)12(19)20/h3-5,15H,2H2,1H3,(H,17,18)(H,19,20)/b16-10+ |
| InChIKey | QVRQAXAWUHLOEA-MHWRWJLKSA-N |
| XLogP | 0.94 |
| TPSA | 149.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|