C12H9Cl3N2O2 — CID 17154962
ethyl (E)-2-cyano-3-(2,4,5-trichloroanilino)prop-2-enoate (PubChem CID 17154962) has the molecular formula C12H9Cl3N2O2 and a molecular weight of 319.58 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-(2,4,5-trichloroanilino)prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-(2,4,5-trichloroanilino)prop-2-enoate |
|---|---|
| PubChem CID | 17154962 |
| Molecular Formula | C12H9Cl3N2O2 |
| Molecular Weight | 319.58 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | ethyl (E)-2-cyano-3-(2,4,5-trichloroanilino)prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H9Cl3N2O2/c1-2-19-12(18)7(5-16)6-17-11-4-9(14)8(13)3-10(11)15/h3-4,6,17H,2H2,1H3/b7-6+ |
| InChIKey | ABEVJSALRIXVOQ-VOTSOKGWSA-N |
| XLogP | 4.03 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|