C12H10Cl3N3O2 — CID 70486646
ethyl 2-cyano-3-[2-(2,3,4-trichlorophenyl)hydrazinyl]prop-2-enoate (PubChem CID 70486646) has the molecular formula C12H10Cl3N3O2 and a molecular weight of 334.59 g/mol. Its IUPAC name is ethyl 2-cyano-3-[2-(2,3,4-trichlorophenyl)hydrazinyl]prop-2-enoate.
| Compound Name | ethyl 2-cyano-3-[2-(2,3,4-trichlorophenyl)hydrazinyl]prop-2-enoate |
|---|---|
| PubChem CID | 70486646 |
| Molecular Formula | C12H10Cl3N3O2 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | ethyl 2-cyano-3-[2-(2,3,4-trichlorophenyl)hydrazinyl]prop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=CNNc1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H10Cl3N3O2/c1-2-20-12(19)7(5-16)6-17-18-9-4-3-8(13)10(14)11(9)15/h3-4,6,17-18H,2H2,1H3 |
| InChIKey | FZMOFHNWGNIUAP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|