C14H14ClN3O4 — CID 8811691
ethyl (E)-3-[2-[2-(2-chlorophenoxy)acetyl]hydrazinyl]-2-cyanoprop-2-enoate (PubChem CID 8811691) has the molecular formula C14H14ClN3O4 and a molecular weight of 323.74 g/mol. Its IUPAC name is ethyl (E)-3-[2-[2-(2-chlorophenoxy)acetyl]hydrazinyl]-2-cyanoprop-2-enoate.
| Compound Name | ethyl (E)-3-[2-[2-(2-chlorophenoxy)acetyl]hydrazinyl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 8811691 |
| Molecular Formula | C14H14ClN3O4 |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | ethyl (E)-3-[2-[2-(2-chlorophenoxy)acetyl]hydrazinyl]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/NNC(=O)COc1ccccc1Cl |
| InChI | InChI=1S/C14H14ClN3O4/c1-2-21-14(20)10(7-16)8-17-18-13(19)9-22-12-6-4-3-5-11(12)15/h3-6,8,17H,2,9H2,1H3,(H,18,19)/b10-8+ |
| InChIKey | AELWOOSCGRYCHZ-CSKARUKUSA-N |
| XLogP | 1.31 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|