C21H20ClNO3 — CID 4064998
ethyl 3-[5-[(2-chlorophenoxy)methyl]-2,4-dimethylphenyl]-2-cyanoprop-2-enoate (PubChem CID 4064998) has the molecular formula C21H20ClNO3 and a molecular weight of 369.85 g/mol. Its IUPAC name is ethyl 3-[5-[(2-chlorophenoxy)methyl]-2,4-dimethylphenyl]-2-cyanoprop-2-enoate.
| Compound Name | ethyl 3-[5-[(2-chlorophenoxy)methyl]-2,4-dimethylphenyl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 4064998 |
| Molecular Formula | C21H20ClNO3 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | ethyl 3-[5-[(2-chlorophenoxy)methyl]-2,4-dimethylphenyl]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=Cc1cc(COc2ccccc2Cl)c(C)cc1C |
| InChI | InChI=1S/C21H20ClNO3/c1-4-25-21(24)17(12-23)10-16-11-18(15(3)9-14(16)2)13-26-20-8-6-5-7-19(20)22/h5-11H,4,13H2,1-3H3 |
| InChIKey | YZALKQROAGVGGP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|