C20H18BrNO3 — CID 6060579
methyl (E)-3-[5-[(4-bromophenoxy)methyl]-2,4-dimethylphenyl]-2-cyanoprop-2-enoate (PubChem CID 6060579) has the molecular formula C20H18BrNO3 and a molecular weight of 400.27 g/mol. Its IUPAC name is methyl (E)-3-[5-[(4-bromophenoxy)methyl]-2,4-dimethylphenyl]-2-cyanoprop-2-enoate.
| Compound Name | methyl (E)-3-[5-[(4-bromophenoxy)methyl]-2,4-dimethylphenyl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 6060579 |
| Molecular Formula | C20H18BrNO3 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | methyl (E)-3-[5-[(4-bromophenoxy)methyl]-2,4-dimethylphenyl]-2-cyanoprop-2-enoate |
| SMILES | COC(=O)/C(C#N)=C/c1cc(COc2ccc(Br)cc2)c(C)cc1C |
| InChI | InChI=1S/C20H18BrNO3/c1-13-8-14(2)17(12-25-19-6-4-18(21)5-7-19)10-15(13)9-16(11-22)20(23)24-3/h4-10H,12H2,1-3H3/b16-9+ |
| InChIKey | DTLIUZICLWSOAN-CXUHLZMHSA-N |
| XLogP | 4.72 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|