C24H22BrN3O2 — CID 21215997
(E)-3-[1-[4-[(4-bromophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]-2-cyano-N-methylprop-2-enamide (PubChem CID 21215997) has the molecular formula C24H22BrN3O2 and a molecular weight of 464.36 g/mol. Its IUPAC name is (E)-3-[1-[4-[(4-bromophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]-2-cyano-N-methylprop-2-enamide.
| Compound Name | (E)-3-[1-[4-[(4-bromophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]-2-cyano-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 21215997 |
| Molecular Formula | C24H22BrN3O2 |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | (E)-3-[1-[4-[(4-bromophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]-2-cyano-N-methylprop-2-enamide |
| SMILES | CNC(=O)/C(C#N)=C/c1cc(C)n(-c2ccc(OCc3ccc(Br)cc3)cc2)c1C |
| InChI | InChI=1S/C24H22BrN3O2/c1-16-12-19(13-20(14-26)24(29)27-3)17(2)28(16)22-8-10-23(11-9-22)30-15-18-4-6-21(25)7-5-18/h4-13H,15H2,1-3H3,(H,27,29)/b20-13+ |
| InChIKey | QYKYICFSTQIQDK-DEDYPNTBSA-N |
| XLogP | 5.09 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|