C16H12BrN2O2- — CID 7063212
(E)-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyanoprop-2-enoate (PubChem CID 7063212) has the molecular formula C16H12BrN2O2- and a molecular weight of 344.19 g/mol. Its IUPAC name is (E)-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyanoprop-2-enoate.
| Compound Name | (E)-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 7063212 |
| Molecular Formula | C16H12BrN2O2- |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | (E)-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyanoprop-2-enoate |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)[O-])c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H13BrN2O2/c1-10-7-12(8-13(9-18)16(20)21)11(2)19(10)15-5-3-14(17)4-6-15/h3-8H,1-2H3,(H,20,21)/p-1/b13-8+ |
| InChIKey | QDQMGHVOSSWKGS-MDWZMJQESA-M |
| XLogP | 2.51 |
| TPSA | 68.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|