C16H14N4O3 — CID 2871794
2-cyano-3-[2,5-dimethyl-1-(4-nitrophenyl)pyrrol-3-yl]prop-2-enamide (PubChem CID 2871794) has the molecular formula C16H14N4O3 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-cyano-3-[2,5-dimethyl-1-(4-nitrophenyl)pyrrol-3-yl]prop-2-enamide.
| Compound Name | 2-cyano-3-[2,5-dimethyl-1-(4-nitrophenyl)pyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 2871794 |
| Molecular Formula | C16H14N4O3 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-cyano-3-[2,5-dimethyl-1-(4-nitrophenyl)pyrrol-3-yl]prop-2-enamide |
| SMILES | Cc1cc(C=C(C#N)C(N)=O)c(C)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H14N4O3/c1-10-7-12(8-13(9-17)16(18)21)11(2)19(10)14-3-5-15(6-4-14)20(22)23/h3-8H,1-2H3,(H2,18,21) |
| InChIKey | NGNUWEJPYIYCGW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|