C31H28N4O3S — CID 126236406
(Z)-2-cyano-3-[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]-N-(3-phenylpropyl)prop-2-enamide (PubChem CID 126236406) has the molecular formula C31H28N4O3S and a molecular weight of 536.66 g/mol. Its IUPAC name is (Z)-2-cyano-3-[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]-N-(3-phenylpropyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]-N-(3-phenylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 126236406 |
| Molecular Formula | C31H28N4O3S |
| Molecular Weight | 536.66 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | (Z)-2-cyano-3-[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]-N-(3-phenylpropyl)prop-2-enamide |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)NCCCc2ccccc2)c(C)n1-c1ccc(Sc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C31H28N4O3S/c1-22-19-25(20-26(21-32)31(36)33-18-6-9-24-7-4-3-5-8-24)23(2)34(22)27-10-14-29(15-11-27)39-30-16-12-28(13-17-30)35(37)38/h3-5,7-8,10-17,19-20H,6,9,18H2,1-2H3,(H,33,36)/b26-20- |
| InChIKey | CLNGQDTVHNPNSL-QOMWVZHYSA-N |
| XLogP | 6.81 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.66 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|