C29H34N4O — CID 126243438
(Z)-2-cyano-3-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-N-(3-phenylpropyl)prop-2-enamide (PubChem CID 126243438) has the molecular formula C29H34N4O and a molecular weight of 454.62 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-N-(3-phenylpropyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-N-(3-phenylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 126243438 |
| Molecular Formula | C29H34N4O |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | (Z)-2-cyano-3-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-N-(3-phenylpropyl)prop-2-enamide |
| SMILES | CCN(CC)c1ccc(-n2c(C)cc(/C=C(/C#N)C(=O)NCCCc3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C29H34N4O/c1-5-32(6-2)27-14-16-28(17-15-27)33-22(3)19-25(23(33)4)20-26(21-30)29(34)31-18-10-13-24-11-8-7-9-12-24/h7-9,11-12,14-17,19-20H,5-6,10,13,18H2,1-4H3,(H,31,34)/b26-20- |
| InChIKey | IXTYMDRPDBHCRJ-QOMWVZHYSA-N |
| XLogP | 5.60 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|