C26H27N3O2 — CID 126227234
(E)-2-cyano-3-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N-(3-phenylpropyl)prop-2-enamide (PubChem CID 126227234) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is (E)-2-cyano-3-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N-(3-phenylpropyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N-(3-phenylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 126227234 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (E)-2-cyano-3-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N-(3-phenylpropyl)prop-2-enamide |
| SMILES | COc1cccc(-n2c(C)cc(/C=C(\C#N)C(=O)NCCCc3ccccc3)c2C)c1 |
| InChI | InChI=1S/C26H27N3O2/c1-19-15-22(20(2)29(19)24-12-7-13-25(17-24)31-3)16-23(18-27)26(30)28-14-8-11-21-9-5-4-6-10-21/h4-7,9-10,12-13,15-17H,8,11,14H2,1-3H3,(H,28,30)/b23-16+ |
| InChIKey | JRVSEJLNVWZGPH-XQNSMLJCSA-N |
| XLogP | 4.76 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|