C32H29Cl2N3O2 — CID 126239447
(Z)-2-cyano-3-[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]-N-(3-phenylpropyl)prop-2-enamide (PubChem CID 126239447) has the molecular formula C32H29Cl2N3O2 and a molecular weight of 558.51 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]-N-(3-phenylpropyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]-N-(3-phenylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 126239447 |
| Molecular Formula | C32H29Cl2N3O2 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | (Z)-2-cyano-3-[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]-N-(3-phenylpropyl)prop-2-enamide |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)NCCCc2ccccc2)c(C)n1-c1ccc(OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C32H29Cl2N3O2/c1-22-17-26(18-27(20-35)32(38)36-16-6-9-24-7-4-3-5-8-24)23(2)37(22)29-12-14-30(15-13-29)39-21-25-10-11-28(33)19-31(25)34/h3-5,7-8,10-15,17-19H,6,9,16,21H2,1-2H3,(H,36,38)/b27-18- |
| InChIKey | UKPRABYRNJIWCO-IMRQLAEWSA-N |
| XLogP | 7.64 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|