C29H24FN3O3 — CID 3432852
2-cyano-3-[1-[4-[(2-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]-N-(4-hydroxyphenyl)prop-2-enamide (PubChem CID 3432852) has the molecular formula C29H24FN3O3 and a molecular weight of 481.53 g/mol. Its IUPAC name is 2-cyano-3-[1-[4-[(2-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]-N-(4-hydroxyphenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[1-[4-[(2-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]-N-(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3432852 |
| Molecular Formula | C29H24FN3O3 |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 2-cyano-3-[1-[4-[(2-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]-N-(4-hydroxyphenyl)prop-2-enamide |
| SMILES | Cc1cc(C=C(C#N)C(=O)Nc2ccc(O)cc2)c(C)n1-c1ccc(OCc2ccccc2F)cc1 |
| InChI | InChI=1S/C29H24FN3O3/c1-19-15-22(16-23(17-31)29(35)32-24-7-11-26(34)12-8-24)20(2)33(19)25-9-13-27(14-10-25)36-18-21-5-3-4-6-28(21)30/h3-16,34H,18H2,1-2H3,(H,32,35) |
| InChIKey | MIQPMNJWCSPHBB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|